C24H36N6O6 — CID 23047505
bis(3-cyclopropyl-5-(1-methylpiperidin-1-ium-4-yl)-1,2,4-oxadiazole);oxalate (PubChem CID 23047505) has the molecular formula C24H36N6O6 and a molecular weight of 504.59 g/mol. Its IUPAC name is bis(3-cyclopropyl-5-(1-methylpiperidin-1-ium-4-yl)-1,2,4-oxadiazole);oxalate.
| Compound Name | bis(3-cyclopropyl-5-(1-methylpiperidin-1-ium-4-yl)-1,2,4-oxadiazole);oxalate |
|---|---|
| PubChem CID | 23047505 |
| Molecular Formula | C24H36N6O6 |
| Molecular Weight | 504.59 g/mol |
| Exact Mass | 504.27 |
| IUPAC Name | bis(3-cyclopropyl-5-(1-methylpiperidin-1-ium-4-yl)-1,2,4-oxadiazole);oxalate |
| SMILES | C[NH+]1CCC(c2nc(C3CC3)no2)CC1.C[NH+]1CCC(c2nc(C3CC3)no2)CC1.O=C([O-])C(=O)[O-] |
| InChI | InChI=1S/2C11H17N3O.C2H2O4/c2*1-14-6-4-9(5-7-14)11-12-10(13-15-11)8-2-3-8;3-1(4)2(5)6/h2*8-9H,2-7H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | YMSOEGGMXWMUFB-UHFFFAOYSA-N |
| XLogP | -2.84 |
| TPSA | 166.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.59 |
| LogP ≤ 5 | -2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|