C24H40N6O6 — CID 23047521
bis(5-(1-methylpiperidin-1-ium-4-yl)-3-propyl-1,2,4-oxadiazole);oxalate (PubChem CID 23047521) has the molecular formula C24H40N6O6 and a molecular weight of 508.62 g/mol. Its IUPAC name is bis(5-(1-methylpiperidin-1-ium-4-yl)-3-propyl-1,2,4-oxadiazole);oxalate.
| Compound Name | bis(5-(1-methylpiperidin-1-ium-4-yl)-3-propyl-1,2,4-oxadiazole);oxalate |
|---|---|
| PubChem CID | 23047521 |
| Molecular Formula | C24H40N6O6 |
| Molecular Weight | 508.62 g/mol |
| Exact Mass | 508.30 |
| IUPAC Name | bis(5-(1-methylpiperidin-1-ium-4-yl)-3-propyl-1,2,4-oxadiazole);oxalate |
| SMILES | CCCc1noc(C2CC[NH+](C)CC2)n1.CCCc1noc(C2CC[NH+](C)CC2)n1.O=C([O-])C(=O)[O-] |
| InChI | InChI=1S/2C11H19N3O.C2H2O4/c2*1-3-4-10-12-11(15-13-10)9-5-7-14(2)8-6-9;3-1(4)2(5)6/h2*9H,3-8H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | DXZMWCNNQYMBJL-UHFFFAOYSA-N |
| XLogP | -2.69 |
| TPSA | 166.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.62 |
| LogP ≤ 5 | -2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|