C15H15N3O5S — CID 23047547
[2-[(2-methoxyphenyl)carbamoylamino]-1,3-thiazol-4-yl] 2-oxobutanoate (PubChem CID 23047547) has the molecular formula C15H15N3O5S and a molecular weight of 349.37 g/mol. Its IUPAC name is [2-[(2-methoxyphenyl)carbamoylamino]-1,3-thiazol-4-yl] 2-oxobutanoate.
| Compound Name | [2-[(2-methoxyphenyl)carbamoylamino]-1,3-thiazol-4-yl] 2-oxobutanoate |
|---|---|
| PubChem CID | 23047547 |
| Molecular Formula | C15H15N3O5S |
| Molecular Weight | 349.37 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | [2-[(2-methoxyphenyl)carbamoylamino]-1,3-thiazol-4-yl] 2-oxobutanoate |
| SMILES | CCC(=O)C(=O)Oc1csc(NC(=O)Nc2ccccc2OC)n1 |
| InChI | InChI=1S/C15H15N3O5S/c1-3-10(19)13(20)23-12-8-24-15(17-12)18-14(21)16-9-6-4-5-7-11(9)22-2/h4-8H,3H2,1-2H3,(H2,16,17,18,21) |
| InChIKey | YWTBSHHXLVVVRA-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.37 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|