C13H15Cl2N3O3 — CID 23048453
ethyl 2-[[3-(2,4-dichlorophenyl)-2H-triazol-1-yl]oxy]propanoate (PubChem CID 23048453) has the molecular formula C13H15Cl2N3O3 and a molecular weight of 332.19 g/mol. Its IUPAC name is ethyl 2-[[3-(2,4-dichlorophenyl)-2H-triazol-1-yl]oxy]propanoate.
| Compound Name | ethyl 2-[[3-(2,4-dichlorophenyl)-2H-triazol-1-yl]oxy]propanoate |
|---|---|
| PubChem CID | 23048453 |
| Molecular Formula | C13H15Cl2N3O3 |
| Molecular Weight | 332.19 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | ethyl 2-[[3-(2,4-dichlorophenyl)-2H-triazol-1-yl]oxy]propanoate |
| SMILES | CCOC(=O)C(C)ON1C=CN(c2ccc(Cl)cc2Cl)N1 |
| InChI | InChI=1S/C13H15Cl2N3O3/c1-3-20-13(19)9(2)21-18-7-6-17(16-18)12-5-4-10(14)8-11(12)15/h4-9,16H,3H2,1-2H3 |
| InChIKey | HGJPJFCCCBTPIN-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.19 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |