About 2-naphthalen-1-yloxyethyl 3-oxopropanoate
2-naphthalen-1-yloxyethyl 3-oxopropanoate (PubChem CID 23049691) has the molecular formula C15H14O4
and a molecular weight of 258.27 g/mol. Its IUPAC name is 2-naphthalen-1-yloxyethyl 3-oxopropanoate.
Molecular Properties
| Compound Name | 2-naphthalen-1-yloxyethyl 3-oxopropanoate |
| PubChem CID | 23049691 |
| Molecular Formula | C15H14O4 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 2-naphthalen-1-yloxyethyl 3-oxopropanoate |
| SMILES | O=CCC(=O)OCCOc1cccc2ccccc12 |
| InChI | InChI=1S/C15H14O4/c16-9-8-15(17)19-11-10-18-14-7-3-5-12-4-1-2-6-13(12)14/h1-7,9H,8,10-11H2 |
| InChIKey | LWKBJMDJTYAPBZ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-naphthalen-1-yloxyethyl 3-oxopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-naphthalen-1-yloxyethyl 3-oxopropanoate?
The IUPAC name of 2-naphthalen-1-yloxyethyl 3-oxopropanoate (CID 23049691) is 2-naphthalen-1-yloxyethyl 3-oxopropanoate.
What is the SMILES notation for 2-naphthalen-1-yloxyethyl 3-oxopropanoate?
The canonical SMILES for 2-naphthalen-1-yloxyethyl 3-oxopropanoate is O=CCC(=O)OCCOc1cccc2ccccc12.
What is the InChIKey of 2-naphthalen-1-yloxyethyl 3-oxopropanoate?
The InChIKey is LWKBJMDJTYAPBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14O4/c16-9-8-15(17)19-11-10-18-14-7-3-5-12-4-1-2-6-13(12)14/h1-7,9H,8,10-11H2.
What are the key properties of 2-naphthalen-1-yloxyethyl 3-oxopropanoate?
2-naphthalen-1-yloxyethyl 3-oxopropanoate has a molecular weight of 258.27 g/mol, XLogP of 2.35, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-naphthalen-1-yloxyethyl 3-oxopropanoate is sourced from PubChem (CID 23049691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).