C13H12ClNO2S — CID 23051815
5-(3-chlorobenzoyl)-4-propan-2-yl-3H-1,3-thiazol-2-one (PubChem CID 23051815) has the molecular formula C13H12ClNO2S and a molecular weight of 281.76 g/mol. Its IUPAC name is 5-(3-chlorobenzoyl)-4-propan-2-yl-3H-1,3-thiazol-2-one.
| Compound Name | 5-(3-chlorobenzoyl)-4-propan-2-yl-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 23051815 |
| Molecular Formula | C13H12ClNO2S |
| Molecular Weight | 281.76 g/mol |
| Exact Mass | 281.03 |
| IUPAC Name | 5-(3-chlorobenzoyl)-4-propan-2-yl-3H-1,3-thiazol-2-one |
| SMILES | CC(C)c1[nH]c(=O)sc1C(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C13H12ClNO2S/c1-7(2)10-12(18-13(17)15-10)11(16)8-4-3-5-9(14)6-8/h3-7H,1-2H3,(H,15,17) |
| InChIKey | INWZKDAOXILOCW-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.76 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |