C20H36NO3Si3 — CID 23051838
CID 23051838 (PubChem CID 23051838) has the molecular formula C20H36NO3Si3 and a molecular weight of 422.77 g/mol.
| Compound Name | CID 23051838 |
|---|---|
| PubChem CID | 23051838 |
| Molecular Formula | C20H36NO3Si3 |
| Molecular Weight | 422.77 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | — |
| SMILES | C=C(C)C(=O)N(c1ccccc1)C(CCC)[Si](O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C20H36NO3Si3/c1-10-14-19(25(23-26(4,5)6)24-27(7,8)9)21(20(22)17(2)3)18-15-12-11-13-16-18/h11-13,15-16,19H,2,10,14H2,1,3-9H3 |
| InChIKey | NNHXUHXAKBPXCI-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.77 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|