C14H10N2O2S — CID 2305660
5-methyl-7-phenyl-2-sulfanylidenepyrano[2,3-d]pyrimidin-4-one (PubChem CID 2305660) has the molecular formula C14H10N2O2S and a molecular weight of 270.31 g/mol. Its IUPAC name is 5-methyl-7-phenyl-2-sulfanylidenepyrano[2,3-d]pyrimidin-4-one.
| Compound Name | 5-methyl-7-phenyl-2-sulfanylidenepyrano[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 2305660 |
| Molecular Formula | C14H10N2O2S |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.05 |
| IUPAC Name | 5-methyl-7-phenyl-2-sulfanylidenepyrano[2,3-d]pyrimidin-4-one |
| SMILES | Cc1cc(-c2ccccc2)oc2nc(=S)[nH]c(=O)c1-2 |
| InChI | InChI=1S/C14H10N2O2S/c1-8-7-10(9-5-3-2-4-6-9)18-13-11(8)12(17)15-14(19)16-13/h2-7H,1H3,(H,15,17,19) |
| InChIKey | JFTZHVGOELOFCO-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|