C18H14N2O3 — CID 23057634
5-[(5-formyl-1H-imidazol-2-yl)methyl]-2-phenylbenzoic acid (PubChem CID 23057634) has the molecular formula C18H14N2O3 and a molecular weight of 306.32 g/mol. Its IUPAC name is 5-[(5-formyl-1H-imidazol-2-yl)methyl]-2-phenylbenzoic acid.
| Compound Name | 5-[(5-formyl-1H-imidazol-2-yl)methyl]-2-phenylbenzoic acid |
|---|---|
| PubChem CID | 23057634 |
| Molecular Formula | C18H14N2O3 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 5-[(5-formyl-1H-imidazol-2-yl)methyl]-2-phenylbenzoic acid |
| SMILES | O=Cc1cnc(Cc2ccc(-c3ccccc3)c(C(=O)O)c2)[nH]1 |
| InChI | InChI=1S/C18H14N2O3/c21-11-14-10-19-17(20-14)9-12-6-7-15(16(8-12)18(22)23)13-4-2-1-3-5-13/h1-8,10-11H,9H2,(H,19,20)(H,22,23) |
| InChIKey | QLVCYFJHHLXXNS-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 83.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|