C23H23ClN2O3 — CID 23060609
6-chloro-2-(cyclohexylamino)-4-(4-methylphenyl)-1-oxoisoquinoline-3-carboxylic acid (PubChem CID 23060609) has the molecular formula C23H23ClN2O3 and a molecular weight of 410.90 g/mol. Its IUPAC name is 6-chloro-2-(cyclohexylamino)-4-(4-methylphenyl)-1-oxoisoquinoline-3-carboxylic acid.
| Compound Name | 6-chloro-2-(cyclohexylamino)-4-(4-methylphenyl)-1-oxoisoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 23060609 |
| Molecular Formula | C23H23ClN2O3 |
| Molecular Weight | 410.90 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | 6-chloro-2-(cyclohexylamino)-4-(4-methylphenyl)-1-oxoisoquinoline-3-carboxylic acid |
| SMILES | Cc1ccc(-c2c(C(=O)O)n(NC3CCCCC3)c(=O)c3ccc(Cl)cc23)cc1 |
| InChI | InChI=1S/C23H23ClN2O3/c1-14-7-9-15(10-8-14)20-19-13-16(24)11-12-18(19)22(27)26(21(20)23(28)29)25-17-5-3-2-4-6-17/h7-13,17,25H,2-6H2,1H3,(H,28,29) |
| InChIKey | CZYFMRBIUCZUTK-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.90 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |