C17H14N2O5 — CID 23062611
2-[2-cyano-4-(phenylmethoxycarbonylamino)phenoxy]acetic acid (PubChem CID 23062611) has the molecular formula C17H14N2O5 and a molecular weight of 326.31 g/mol. Its IUPAC name is 2-[2-cyano-4-(phenylmethoxycarbonylamino)phenoxy]acetic acid.
| Compound Name | 2-[2-cyano-4-(phenylmethoxycarbonylamino)phenoxy]acetic acid |
|---|---|
| PubChem CID | 23062611 |
| Molecular Formula | C17H14N2O5 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 2-[2-cyano-4-(phenylmethoxycarbonylamino)phenoxy]acetic acid |
| SMILES | N#Cc1cc(NC(=O)OCc2ccccc2)ccc1OCC(=O)O |
| InChI | InChI=1S/C17H14N2O5/c18-9-13-8-14(6-7-15(13)23-11-16(20)21)19-17(22)24-10-12-4-2-1-3-5-12/h1-8H,10-11H2,(H,19,22)(H,20,21) |
| InChIKey | YUSVEUJKPFSVAW-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 108.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |