benzyl N-(3-chloro-2-cyano-1-benzothiophen-6-yl)carbamate

C17H11ClN2O2S — CID 21332187

IUPACbenzyl N-(3-chloro-2-cyano-1-benzothiophen-6-yl)carbamate
SMILESN#Cc1sc2cc(NC(=O)OCc3ccccc3)ccc2c1Cl
InChIInChI=1S/C17H11ClN2O2S/c18-16-13-7-6-12(8-14(13)23-15(16)9-19)20-17(21)22-10-11-4-2-1-3-5-11/h1-8H,10H2,(H,20,21)
InChIKeyVEIKTVAENSWMPB-UHFFFAOYSA-N
MW342.81 g/mol
LogP5.18
Rot. Bonds3

About benzyl N-(3-chloro-2-cyano-1-benzothiophen-6-yl)carbamate

benzyl N-(3-chloro-2-cyano-1-benzothiophen-6-yl)carbamate (PubChem CID 21332187) has the molecular formula C17H11ClN2O2S and a molecular weight of 342.81 g/mol. Its IUPAC name is benzyl N-(3-chloro-2-cyano-1-benzothiophen-6-yl)carbamate.

Molecular Properties

Compound Namebenzyl N-(3-chloro-2-cyano-1-benzothiophen-6-yl)carbamate
PubChem CID21332187
Molecular FormulaC17H11ClN2O2S
Molecular Weight342.81 g/mol
Exact Mass342.02
IUPAC Namebenzyl N-(3-chloro-2-cyano-1-benzothiophen-6-yl)carbamate
SMILESN#Cc1sc2cc(NC(=O)OCc3ccccc3)ccc2c1Cl
InChIInChI=1S/C17H11ClN2O2S/c18-16-13-7-6-12(8-14(13)23-15(16)9-19)20-17(21)22-10-11-4-2-1-3-5-11/h1-8H,10H2,(H,20,21)
InChIKeyVEIKTVAENSWMPB-UHFFFAOYSA-N
XLogP5.18
TPSA62.12 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms23
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500342.81
LogP ≤ 55.18
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze benzyl N-(3-chloro-2-cyano-1-benzothiophen-6-yl)carbamate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl N-(3-chloro-2-cyano-1-benzothiophen-6-yl)carbamate?
The IUPAC name of benzyl N-(3-chloro-2-cyano-1-benzothiophen-6-yl)carbamate (CID 21332187) is benzyl N-(3-chloro-2-cyano-1-benzothiophen-6-yl)carbamate.
What is the SMILES notation for benzyl N-(3-chloro-2-cyano-1-benzothiophen-6-yl)carbamate?
The canonical SMILES for benzyl N-(3-chloro-2-cyano-1-benzothiophen-6-yl)carbamate is N#Cc1sc2cc(NC(=O)OCc3ccccc3)ccc2c1Cl.
What is the InChIKey of benzyl N-(3-chloro-2-cyano-1-benzothiophen-6-yl)carbamate?
The InChIKey is VEIKTVAENSWMPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11ClN2O2S/c18-16-13-7-6-12(8-14(13)23-15(16)9-19)20-17(21)22-10-11-4-2-1-3-5-11/h1-8H,10H2,(H,20,21).
What are the key properties of benzyl N-(3-chloro-2-cyano-1-benzothiophen-6-yl)carbamate?
benzyl N-(3-chloro-2-cyano-1-benzothiophen-6-yl)carbamate has a molecular weight of 342.81 g/mol, XLogP of 5.18, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl N-(3-chloro-2-cyano-1-benzothiophen-6-yl)carbamate is sourced from PubChem (CID 21332187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).