About 2-hydroxy-1,3-dimethyl-2,7-dihydropurin-6-one
2-hydroxy-1,3-dimethyl-2,7-dihydropurin-6-one (PubChem CID 23064270) has the molecular formula C7H10N4O2
and a molecular weight of 182.18 g/mol. Its IUPAC name is 2-hydroxy-1,3-dimethyl-2,7-dihydropurin-6-one.
Molecular Properties
| Compound Name | 2-hydroxy-1,3-dimethyl-2,7-dihydropurin-6-one |
| PubChem CID | 23064270 |
| Molecular Formula | C7H10N4O2 |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | 2-hydroxy-1,3-dimethyl-2,7-dihydropurin-6-one |
| SMILES | CN1C(=O)c2[nH]cnc2N(C)C1O |
| InChI | InChI=1S/C7H10N4O2/c1-10-5-4(8-3-9-5)6(12)11(2)7(10)13/h3,7,13H,1-2H3,(H,8,9) |
| InChIKey | OBGAXKSGCBIARN-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 72.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-hydroxy-1,3-dimethyl-2,7-dihydropurin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-1,3-dimethyl-2,7-dihydropurin-6-one?
The IUPAC name of 2-hydroxy-1,3-dimethyl-2,7-dihydropurin-6-one (CID 23064270) is 2-hydroxy-1,3-dimethyl-2,7-dihydropurin-6-one.
What is the SMILES notation for 2-hydroxy-1,3-dimethyl-2,7-dihydropurin-6-one?
The canonical SMILES for 2-hydroxy-1,3-dimethyl-2,7-dihydropurin-6-one is CN1C(=O)c2[nH]cnc2N(C)C1O.
What is the InChIKey of 2-hydroxy-1,3-dimethyl-2,7-dihydropurin-6-one?
The InChIKey is OBGAXKSGCBIARN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N4O2/c1-10-5-4(8-3-9-5)6(12)11(2)7(10)13/h3,7,13H,1-2H3,(H,8,9).
What are the key properties of 2-hydroxy-1,3-dimethyl-2,7-dihydropurin-6-one?
2-hydroxy-1,3-dimethyl-2,7-dihydropurin-6-one has a molecular weight of 182.18 g/mol, XLogP of -0.79, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-1,3-dimethyl-2,7-dihydropurin-6-one is sourced from PubChem (CID 23064270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).