C8H14O2 — CID 23064937
2-methyl-4-(3-methylbut-2-enyl)-1,3-dioxetane (PubChem CID 23064937) has the molecular formula C8H14O2 and a molecular weight of 142.20 g/mol. Its IUPAC name is 2-methyl-4-(3-methylbut-2-enyl)-1,3-dioxetane.
| Compound Name | 2-methyl-4-(3-methylbut-2-enyl)-1,3-dioxetane |
|---|---|
| PubChem CID | 23064937 |
| Molecular Formula | C8H14O2 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | 2-methyl-4-(3-methylbut-2-enyl)-1,3-dioxetane |
| SMILES | CC(C)=CCC1OC(C)O1 |
| InChI | InChI=1S/C8H14O2/c1-6(2)4-5-8-9-7(3)10-8/h4,7-8H,5H2,1-3H3 |
| InChIKey | ULAOSUSUSIBVGA-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|