C9H18N2 — CID 23065764
3-butyl-1,4-dimethyl-2H-imidazole (PubChem CID 23065764) has the molecular formula C9H18N2 and a molecular weight of 154.26 g/mol. Its IUPAC name is 3-butyl-1,4-dimethyl-2H-imidazole.
| Compound Name | 3-butyl-1,4-dimethyl-2H-imidazole |
|---|---|
| PubChem CID | 23065764 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | 3-butyl-1,4-dimethyl-2H-imidazole |
| SMILES | CCCCN1CN(C)C=C1C |
| InChI | InChI=1S/C9H18N2/c1-4-5-6-11-8-10(3)7-9(11)2/h7H,4-6,8H2,1-3H3 |
| InChIKey | BKMCRPAWKNPQKX-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |