C6H5NO10-4 — CID 23069429
2-hydroxypropane-1,2,3-tricarboxylate nitrate (PubChem CID 23069429) has the molecular formula C6H5NO10-4 and a molecular weight of 251.10 g/mol. Its IUPAC name is 2-hydroxypropane-1,2,3-tricarboxylate nitrate.
| Compound Name | 2-hydroxypropane-1,2,3-tricarboxylate nitrate |
|---|---|
| PubChem CID | 23069429 |
| Molecular Formula | C6H5NO10-4 |
| Molecular Weight | 251.10 g/mol |
| Exact Mass | 250.99 |
| IUPAC Name | 2-hydroxypropane-1,2,3-tricarboxylate nitrate |
| SMILES | O=C([O-])CC(O)(CC(=O)[O-])C(=O)[O-].O=[N+]([O-])[O-] |
| InChI | InChI=1S/C6H8O7.NO3/c7-3(8)1-6(13,5(11)12)2-4(9)10;2-1(3)4/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);/q;-1/p-3 |
| InChIKey | FTKNPDGQPCOFQF-UHFFFAOYSA-K |
| XLogP | -5.49 |
| TPSA | 206.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.10 |
| LogP ≤ 5 | -5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|