2-hydroxypropane-1,2,3-tricarboxylate nitrate

C6H5NO10-4 — CID 23069429

IUPAC2-hydroxypropane-1,2,3-tricarboxylate nitrate
SMILESO=C([O-])CC(O)(CC(=O)[O-])C(=O)[O-].O=[N+]([O-])[O-]
InChIInChI=1S/C6H8O7.NO3/c7-3(8)1-6(13,5(11)12)2-4(9)10;2-1(3)4/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);/q;-1/p-3
InChIKeyFTKNPDGQPCOFQF-UHFFFAOYSA-K
MW251.10 g/mol
LogP-5.49
Rot. Bonds5

About 2-hydroxypropane-1,2,3-tricarboxylate nitrate

2-hydroxypropane-1,2,3-tricarboxylate nitrate (PubChem CID 23069429) has the molecular formula C6H5NO10-4 and a molecular weight of 251.10 g/mol. Its IUPAC name is 2-hydroxypropane-1,2,3-tricarboxylate nitrate.

Molecular Properties

Compound Name2-hydroxypropane-1,2,3-tricarboxylate nitrate
PubChem CID23069429
Molecular FormulaC6H5NO10-4
Molecular Weight251.10 g/mol
Exact Mass250.99
IUPAC Name2-hydroxypropane-1,2,3-tricarboxylate nitrate
SMILESO=C([O-])CC(O)(CC(=O)[O-])C(=O)[O-].O=[N+]([O-])[O-]
InChIInChI=1S/C6H8O7.NO3/c7-3(8)1-6(13,5(11)12)2-4(9)10;2-1(3)4/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);/q;-1/p-3
InChIKeyFTKNPDGQPCOFQF-UHFFFAOYSA-K
XLogP-5.49
TPSA206.82 Ų
H-Bond Donors1
H-Bond Acceptors10
Rotatable Bonds5
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500251.10
LogP ≤ 5-5.49
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 1010

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 2-hydroxypropane-1,2,3-tricarboxylate nitrate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-hydroxypropane-1,2,3-tricarboxylate nitrate?
The IUPAC name of 2-hydroxypropane-1,2,3-tricarboxylate nitrate (CID 23069429) is 2-hydroxypropane-1,2,3-tricarboxylate nitrate.
What is the SMILES notation for 2-hydroxypropane-1,2,3-tricarboxylate nitrate?
The canonical SMILES for 2-hydroxypropane-1,2,3-tricarboxylate nitrate is O=C([O-])CC(O)(CC(=O)[O-])C(=O)[O-].O=[N+]([O-])[O-].
What is the InChIKey of 2-hydroxypropane-1,2,3-tricarboxylate nitrate?
The InChIKey is FTKNPDGQPCOFQF-UHFFFAOYSA-K. The full InChI is InChI=1S/C6H8O7.NO3/c7-3(8)1-6(13,5(11)12)2-4(9)10;2-1(3)4/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);/q;-1/p-3.
What are the key properties of 2-hydroxypropane-1,2,3-tricarboxylate nitrate?
2-hydroxypropane-1,2,3-tricarboxylate nitrate has a molecular weight of 251.10 g/mol, XLogP of -5.49, 5 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxypropane-1,2,3-tricarboxylate nitrate is sourced from PubChem (CID 23069429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).