C17H32N3+3 — CID 2307074
1-(5,5-dimethyl-3-pyrrolidin-1-ium-1-ylidenecyclohexen-1-yl)-4-methylpiperazine-1,4-diium (PubChem CID 2307074) has the molecular formula C17H32N3+3 and a molecular weight of 278.46 g/mol. Its IUPAC name is 1-(5,5-dimethyl-3-pyrrolidin-1-ium-1-ylidenecyclohexen-1-yl)-4-methylpiperazine-1,4-diium.
| Compound Name | 1-(5,5-dimethyl-3-pyrrolidin-1-ium-1-ylidenecyclohexen-1-yl)-4-methylpiperazine-1,4-diium |
|---|---|
| PubChem CID | 2307074 |
| Molecular Formula | C17H32N3+3 |
| Molecular Weight | 278.46 g/mol |
| Exact Mass | 278.26 |
| IUPAC Name | 1-(5,5-dimethyl-3-pyrrolidin-1-ium-1-ylidenecyclohexen-1-yl)-4-methylpiperazine-1,4-diium |
| SMILES | C[NH+]1CC[NH+](C2=CC(=[N+]3CCCC3)CC(C)(C)C2)CC1 |
| InChI | InChI=1S/C17H30N3/c1-17(2)13-15(19-6-4-5-7-19)12-16(14-17)20-10-8-18(3)9-11-20/h12H,4-11,13-14H2,1-3H3/q+1/p+2 |
| InChIKey | HQTMCTGDGMBQHX-UHFFFAOYSA-P |
| XLogP | -0.65 |
| TPSA | 11.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.46 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|