C17H30N3+ — CID 2307075
1-(5,5-dimethyl-3-pyrrolidin-1-ium-1-ylidenecyclohexen-1-yl)-4-methylpiperazine (PubChem CID 2307075) has the molecular formula C17H30N3+ and a molecular weight of 276.45 g/mol. Its IUPAC name is 1-(5,5-dimethyl-3-pyrrolidin-1-ium-1-ylidenecyclohexen-1-yl)-4-methylpiperazine.
| Compound Name | 1-(5,5-dimethyl-3-pyrrolidin-1-ium-1-ylidenecyclohexen-1-yl)-4-methylpiperazine |
|---|---|
| PubChem CID | 2307075 |
| Molecular Formula | C17H30N3+ |
| Molecular Weight | 276.45 g/mol |
| Exact Mass | 276.24 |
| IUPAC Name | 1-(5,5-dimethyl-3-pyrrolidin-1-ium-1-ylidenecyclohexen-1-yl)-4-methylpiperazine |
| SMILES | CN1CCN(C2=CC(=[N+]3CCCC3)CC(C)(C)C2)CC1 |
| InChI | InChI=1S/C17H30N3/c1-17(2)13-15(19-6-4-5-7-19)12-16(14-17)20-10-8-18(3)9-11-20/h12H,4-11,13-14H2,1-3H3/q+1 |
| InChIKey | HQTMCTGDGMBQHX-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 9.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.45 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|