C19H21FN2O3 — CID 23073334
3-[ethoxy-[(3-fluorophenyl)methyl]amino]pyrrolidin-2-one;7-oxabicyclo[2.2.1]hepta-1,3,5-triene (PubChem CID 23073334) has the molecular formula C19H21FN2O3 and a molecular weight of 344.39 g/mol. Its IUPAC name is 3-[ethoxy-[(3-fluorophenyl)methyl]amino]pyrrolidin-2-one;7-oxabicyclo[2.2.1]hepta-1,3,5-triene.
| Compound Name | 3-[ethoxy-[(3-fluorophenyl)methyl]amino]pyrrolidin-2-one;7-oxabicyclo[2.2.1]hepta-1,3,5-triene |
|---|---|
| PubChem CID | 23073334 |
| Molecular Formula | C19H21FN2O3 |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 3-[ethoxy-[(3-fluorophenyl)methyl]amino]pyrrolidin-2-one;7-oxabicyclo[2.2.1]hepta-1,3,5-triene |
| SMILES | CCON(Cc1cccc(F)c1)C1CCNC1=O.c1cc2ccc1o2 |
| InChI | InChI=1S/C13H17FN2O2.C6H4O/c1-2-18-16(12-6-7-15-13(12)17)9-10-4-3-5-11(14)8-10;1-2-6-4-3-5(1)7-6/h3-5,8,12H,2,6-7,9H2,1H3,(H,15,17);1-4H |
| InChIKey | HAOOLTNFJVRVJR-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|