C13H14O3S — CID 23074478
ethyl 3-(5-hydroxy-1-benzothiophen-2-yl)propanoate (PubChem CID 23074478) has the molecular formula C13H14O3S and a molecular weight of 250.32 g/mol. Its IUPAC name is ethyl 3-(5-hydroxy-1-benzothiophen-2-yl)propanoate.
| Compound Name | ethyl 3-(5-hydroxy-1-benzothiophen-2-yl)propanoate |
|---|---|
| PubChem CID | 23074478 |
| Molecular Formula | C13H14O3S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | ethyl 3-(5-hydroxy-1-benzothiophen-2-yl)propanoate |
| SMILES | CCOC(=O)CCc1cc2cc(O)ccc2s1 |
| InChI | InChI=1S/C13H14O3S/c1-2-16-13(15)6-4-11-8-9-7-10(14)3-5-12(9)17-11/h3,5,7-8,14H,2,4,6H2,1H3 |
| InChIKey | SEFCLQSSFPLOGO-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |