C17H12BrClN4O5S — CID 23075716
N-(5-bromo-3-phenylmethoxypyrazin-2-yl)-4-chloro-3-nitrobenzenesulfonamide (PubChem CID 23075716) has the molecular formula C17H12BrClN4O5S and a molecular weight of 499.73 g/mol. Its IUPAC name is N-(5-bromo-3-phenylmethoxypyrazin-2-yl)-4-chloro-3-nitrobenzenesulfonamide.
| Compound Name | N-(5-bromo-3-phenylmethoxypyrazin-2-yl)-4-chloro-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 23075716 |
| Molecular Formula | C17H12BrClN4O5S |
| Molecular Weight | 499.73 g/mol |
| Exact Mass | 497.94 |
| IUPAC Name | N-(5-bromo-3-phenylmethoxypyrazin-2-yl)-4-chloro-3-nitrobenzenesulfonamide |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)Nc2ncc(Br)nc2OCc2ccccc2)ccc1Cl |
| InChI | InChI=1S/C17H12BrClN4O5S/c18-15-9-20-16(17(21-15)28-10-11-4-2-1-3-5-11)22-29(26,27)12-6-7-13(19)14(8-12)23(24)25/h1-9H,10H2,(H,20,22) |
| InChIKey | ANWRKCUIBSLHQF-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 124.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.73 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|