C11H8BrCl2N3O3S — CID 10309892
N-(5-bromo-3-methoxypyrazin-2-yl)-3,5-dichlorobenzenesulfonamide (PubChem CID 10309892) has the molecular formula C11H8BrCl2N3O3S and a molecular weight of 413.08 g/mol. Its IUPAC name is N-(5-bromo-3-methoxypyrazin-2-yl)-3,5-dichlorobenzenesulfonamide.
| Compound Name | N-(5-bromo-3-methoxypyrazin-2-yl)-3,5-dichlorobenzenesulfonamide |
|---|---|
| PubChem CID | 10309892 |
| Molecular Formula | C11H8BrCl2N3O3S |
| Molecular Weight | 413.08 g/mol |
| Exact Mass | 410.88 |
| IUPAC Name | N-(5-bromo-3-methoxypyrazin-2-yl)-3,5-dichlorobenzenesulfonamide |
| SMILES | COc1nc(Br)cnc1NS(=O)(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C11H8BrCl2N3O3S/c1-20-11-10(15-5-9(12)16-11)17-21(18,19)8-3-6(13)2-7(14)4-8/h2-5H,1H3,(H,15,17) |
| InChIKey | ZFPLJZKWRIHEGH-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.08 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |