C15H10Cl2N2O2S — CID 3792494
3,5-dichloro-N-isoquinolin-1-ylbenzenesulfonamide (PubChem CID 3792494) has the molecular formula C15H10Cl2N2O2S and a molecular weight of 353.23 g/mol. Its IUPAC name is 3,5-dichloro-N-isoquinolin-1-ylbenzenesulfonamide.
| Compound Name | 3,5-dichloro-N-isoquinolin-1-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 3792494 |
| Molecular Formula | C15H10Cl2N2O2S |
| Molecular Weight | 353.23 g/mol |
| Exact Mass | 351.98 |
| IUPAC Name | 3,5-dichloro-N-isoquinolin-1-ylbenzenesulfonamide |
| SMILES | O=S(=O)(Nc1nccc2ccccc12)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C15H10Cl2N2O2S/c16-11-7-12(17)9-13(8-11)22(20,21)19-15-14-4-2-1-3-10(14)5-6-18-15/h1-9H,(H,18,19) |
| InChIKey | GRABGUKJNKAIKD-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.23 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |