C11H10BN3O4S — CID 88884928
CID 88884928 (PubChem CID 88884928) has the molecular formula C11H10BN3O4S and a molecular weight of 291.10 g/mol.
| Compound Name | CID 88884928 |
|---|---|
| PubChem CID | 88884928 |
| Molecular Formula | C11H10BN3O4S |
| Molecular Weight | 291.10 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | — |
| SMILES | [B]c1cnc(NS(=O)(=O)c2ccc(O)cc2)c(OC)n1 |
| InChI | InChI=1S/C11H10BN3O4S/c1-19-11-10(13-6-9(12)14-11)15-20(17,18)8-4-2-7(16)3-5-8/h2-6,16H,1H3,(H,13,15) |
| InChIKey | PROGNVAGZQTSNF-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 101.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.10 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|