C16H13FN4O3S — CID 23075975
4-fluoro-N-[3-(pyridin-4-ylmethoxy)pyrazin-2-yl]benzenesulfonamide (PubChem CID 23075975) has the molecular formula C16H13FN4O3S and a molecular weight of 360.37 g/mol. Its IUPAC name is 4-fluoro-N-[3-(pyridin-4-ylmethoxy)pyrazin-2-yl]benzenesulfonamide.
| Compound Name | 4-fluoro-N-[3-(pyridin-4-ylmethoxy)pyrazin-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 23075975 |
| Molecular Formula | C16H13FN4O3S |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | 4-fluoro-N-[3-(pyridin-4-ylmethoxy)pyrazin-2-yl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1nccnc1OCc1ccncc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H13FN4O3S/c17-13-1-3-14(4-2-13)25(22,23)21-15-16(20-10-9-19-15)24-11-12-5-7-18-8-6-12/h1-10H,11H2,(H,19,21) |
| InChIKey | FPJXHVLCHJLARE-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 94.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |