C20H15FN4O3S — CID 23075789
4-fluoro-N-[3-(pyridin-3-ylmethoxy)quinoxalin-2-yl]benzenesulfonamide (PubChem CID 23075789) has the molecular formula C20H15FN4O3S and a molecular weight of 410.43 g/mol. Its IUPAC name is 4-fluoro-N-[3-(pyridin-3-ylmethoxy)quinoxalin-2-yl]benzenesulfonamide.
| Compound Name | 4-fluoro-N-[3-(pyridin-3-ylmethoxy)quinoxalin-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 23075789 |
| Molecular Formula | C20H15FN4O3S |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | 4-fluoro-N-[3-(pyridin-3-ylmethoxy)quinoxalin-2-yl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1nc2ccccc2nc1OCc1cccnc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H15FN4O3S/c21-15-7-9-16(10-8-15)29(26,27)25-19-20(28-13-14-4-3-11-22-12-14)24-18-6-2-1-5-17(18)23-19/h1-12H,13H2,(H,23,25) |
| InChIKey | ZQSCUORBDGBQPX-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 94.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |