C23H22N4O4S — CID 23075922
4-methoxy-N-[3-(3-pyridin-3-ylpropoxy)quinoxalin-2-yl]benzenesulfonamide (PubChem CID 23075922) has the molecular formula C23H22N4O4S and a molecular weight of 450.52 g/mol. Its IUPAC name is 4-methoxy-N-[3-(3-pyridin-3-ylpropoxy)quinoxalin-2-yl]benzenesulfonamide.
| Compound Name | 4-methoxy-N-[3-(3-pyridin-3-ylpropoxy)quinoxalin-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 23075922 |
| Molecular Formula | C23H22N4O4S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | 4-methoxy-N-[3-(3-pyridin-3-ylpropoxy)quinoxalin-2-yl]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2nc3ccccc3nc2OCCCc2cccnc2)cc1 |
| InChI | InChI=1S/C23H22N4O4S/c1-30-18-10-12-19(13-11-18)32(28,29)27-22-23(26-21-9-3-2-8-20(21)25-22)31-15-5-7-17-6-4-14-24-16-17/h2-4,6,8-14,16H,5,7,15H2,1H3,(H,25,27) |
| InChIKey | VVSDONQJEMWBTL-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 103.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|