C27H22N4O3S — CID 23076292
4-methyl-N-[5-naphthalen-1-yl-3-(pyridin-3-ylmethoxy)pyrazin-2-yl]benzenesulfonamide (PubChem CID 23076292) has the molecular formula C27H22N4O3S and a molecular weight of 482.57 g/mol. Its IUPAC name is 4-methyl-N-[5-naphthalen-1-yl-3-(pyridin-3-ylmethoxy)pyrazin-2-yl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[5-naphthalen-1-yl-3-(pyridin-3-ylmethoxy)pyrazin-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 23076292 |
| Molecular Formula | C27H22N4O3S |
| Molecular Weight | 482.57 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | 4-methyl-N-[5-naphthalen-1-yl-3-(pyridin-3-ylmethoxy)pyrazin-2-yl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ncc(-c3cccc4ccccc34)nc2OCc2cccnc2)cc1 |
| InChI | InChI=1S/C27H22N4O3S/c1-19-11-13-22(14-12-19)35(32,33)31-26-27(34-18-20-6-5-15-28-16-20)30-25(17-29-26)24-10-4-8-21-7-2-3-9-23(21)24/h2-17H,18H2,1H3,(H,29,31) |
| InChIKey | UGVQQCBPVSLTKQ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 94.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.57 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |