C13H24NO+ — CID 23079606
2-ethyl-3-pentyl-4-propan-2-yl-1,3-oxazol-3-ium (PubChem CID 23079606) has the molecular formula C13H24NO+ and a molecular weight of 210.34 g/mol. Its IUPAC name is 2-ethyl-3-pentyl-4-propan-2-yl-1,3-oxazol-3-ium.
| Compound Name | 2-ethyl-3-pentyl-4-propan-2-yl-1,3-oxazol-3-ium |
|---|---|
| PubChem CID | 23079606 |
| Molecular Formula | C13H24NO+ |
| Molecular Weight | 210.34 g/mol |
| Exact Mass | 210.19 |
| IUPAC Name | 2-ethyl-3-pentyl-4-propan-2-yl-1,3-oxazol-3-ium |
| SMILES | CCCCC[n+]1c(C(C)C)coc1CC |
| InChI | InChI=1S/C13H24NO/c1-5-7-8-9-14-12(11(3)4)10-15-13(14)6-2/h10-11H,5-9H2,1-4H3/q+1 |
| InChIKey | AFMJAACRQUDEJY-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.34 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|