C12H22NO+ — CID 151190612
2-methyl-3-octyl-1,3-oxazol-3-ium (PubChem CID 151190612) has the molecular formula C12H22NO+ and a molecular weight of 196.31 g/mol. Its IUPAC name is 2-methyl-3-octyl-1,3-oxazol-3-ium.
| Compound Name | 2-methyl-3-octyl-1,3-oxazol-3-ium |
|---|---|
| PubChem CID | 151190612 |
| Molecular Formula | C12H22NO+ |
| Molecular Weight | 196.31 g/mol |
| Exact Mass | 196.17 |
| IUPAC Name | 2-methyl-3-octyl-1,3-oxazol-3-ium |
| SMILES | CCCCCCCC[n+]1ccoc1C |
| InChI | InChI=1S/C12H22NO/c1-3-4-5-6-7-8-9-13-10-11-14-12(13)2/h10-11H,3-9H2,1-2H3/q+1 |
| InChIKey | NGFUZYJHBACKFY-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.31 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|