C15H26BrN — CID 46210877
2,3-dimethyl-1-octylpyridin-1-ium bromide (PubChem CID 46210877) has the molecular formula C15H26BrN and a molecular weight of 300.28 g/mol. Its IUPAC name is 2,3-dimethyl-1-octylpyridin-1-ium bromide.
| Compound Name | 2,3-dimethyl-1-octylpyridin-1-ium bromide |
|---|---|
| PubChem CID | 46210877 |
| Molecular Formula | C15H26BrN |
| Molecular Weight | 300.28 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 2,3-dimethyl-1-octylpyridin-1-ium bromide |
| SMILES | CCCCCCCC[n+]1cccc(C)c1C.[Br-] |
| InChI | InChI=1S/C15H26N.BrH/c1-4-5-6-7-8-9-12-16-13-10-11-14(2)15(16)3;/h10-11,13H,4-9,12H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | HGQNXOSMJCGGNO-UHFFFAOYSA-M |
| XLogP | 0.96 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.28 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|