C15H26F6NSb — CID 159998256
2,3-dimethyl-1-octylpyridin-1-ium;hexafluoroantimony(1-) (PubChem CID 159998256) has the molecular formula C15H26F6NSb and a molecular weight of 456.13 g/mol. Its IUPAC name is 2,3-dimethyl-1-octylpyridin-1-ium;hexafluoroantimony(1-).
| Compound Name | 2,3-dimethyl-1-octylpyridin-1-ium;hexafluoroantimony(1-) |
|---|---|
| PubChem CID | 159998256 |
| Molecular Formula | C15H26F6NSb |
| Molecular Weight | 456.13 g/mol |
| Exact Mass | 455.10 |
| IUPAC Name | 2,3-dimethyl-1-octylpyridin-1-ium;hexafluoroantimony(1-) |
| SMILES | CCCCCCCC[n+]1cccc(C)c1C.F[Sb-](F)(F)(F)(F)F |
| InChI | InChI=1S/C15H26N.6FH.Sb/c1-4-5-6-7-8-9-12-16-13-10-11-14(2)15(16)3;;;;;;;/h10-11,13H,4-9,12H2,1-3H3;6*1H;/q+1;;;;;;;+5/p-6 |
| InChIKey | OHVBSWURRLCHRZ-UHFFFAOYSA-H |
| XLogP | 6.09 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.13 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|