C15H20N2+2 — CID 91326704
2,3-dimethyl-1-[2-(1-methylpyridin-1-ium-4-yl)ethyl]pyridin-1-ium (PubChem CID 91326704) has the molecular formula C15H20N2+2 and a molecular weight of 228.34 g/mol. Its IUPAC name is 2,3-dimethyl-1-[2-(1-methylpyridin-1-ium-4-yl)ethyl]pyridin-1-ium.
| Compound Name | 2,3-dimethyl-1-[2-(1-methylpyridin-1-ium-4-yl)ethyl]pyridin-1-ium |
|---|---|
| PubChem CID | 91326704 |
| Molecular Formula | C15H20N2+2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | 2,3-dimethyl-1-[2-(1-methylpyridin-1-ium-4-yl)ethyl]pyridin-1-ium |
| SMILES | Cc1ccc[n+](CCc2cc[n+](C)cc2)c1C |
| InChI | InChI=1S/C15H20N2/c1-13-5-4-9-17(14(13)2)12-8-15-6-10-16(3)11-7-15/h4-7,9-11H,8,12H2,1-3H3/q+2 |
| InChIKey | RXVNKYZRCHXYQF-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|