C14H20N2O3 — CID 174558723
bis(2,3-dimethyl-1-oxidopyridin-1-ium);hydrate (PubChem CID 174558723) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is bis(2,3-dimethyl-1-oxidopyridin-1-ium);hydrate.
| Compound Name | bis(2,3-dimethyl-1-oxidopyridin-1-ium);hydrate |
|---|---|
| PubChem CID | 174558723 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | bis(2,3-dimethyl-1-oxidopyridin-1-ium);hydrate |
| SMILES | Cc1ccc[n+]([O-])c1C.Cc1ccc[n+]([O-])c1C.O |
| InChI | InChI=1S/2C7H9NO.H2O/c2*1-6-4-3-5-8(9)7(6)2;/h2*3-5H,1-2H3;1H2 |
| InChIKey | PBTCKFQXNXNMAV-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|