C13H16N2O — CID 70439845
3-(2,6-dimethyl-1,4-dihydropyridin-4-yl)-2-methyl-1-oxidopyridin-1-ium (PubChem CID 70439845) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is 3-(2,6-dimethyl-1,4-dihydropyridin-4-yl)-2-methyl-1-oxidopyridin-1-ium.
| Compound Name | 3-(2,6-dimethyl-1,4-dihydropyridin-4-yl)-2-methyl-1-oxidopyridin-1-ium |
|---|---|
| PubChem CID | 70439845 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 3-(2,6-dimethyl-1,4-dihydropyridin-4-yl)-2-methyl-1-oxidopyridin-1-ium |
| SMILES | CC1=CC(c2ccc[n+]([O-])c2C)C=C(C)N1 |
| InChI | InChI=1S/C13H16N2O/c1-9-7-12(8-10(2)14-9)13-5-4-6-15(16)11(13)3/h4-8,12,14H,1-3H3 |
| InChIKey | JLPYZJMDXUNDJW-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 38.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|