C24H36CuN2O4 — CID 139164120
copper bis(1-hexyl-2-methylpyridin-1-ium-3,4-diolate) (PubChem CID 139164120) has the molecular formula C24H36CuN2O4 and a molecular weight of 480.11 g/mol. Its IUPAC name is copper bis(1-hexyl-2-methylpyridin-1-ium-3,4-diolate).
| Compound Name | copper bis(1-hexyl-2-methylpyridin-1-ium-3,4-diolate) |
|---|---|
| PubChem CID | 139164120 |
| Molecular Formula | C24H36CuN2O4 |
| Molecular Weight | 480.11 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | copper bis(1-hexyl-2-methylpyridin-1-ium-3,4-diolate) |
| SMILES | CCCCCC[n+]1ccc([O-])c([O-])c1C.CCCCCC[n+]1ccc([O-])c([O-])c1C.[Cu+2] |
| InChI | InChI=1S/2C12H19NO2.Cu/c2*1-3-4-5-6-8-13-9-7-11(14)12(15)10(13)2;/h2*7,9,15H,3-6,8H2,1-2H3;/q;;+2/p-2 |
| InChIKey | XCFGXOSIPBIPKO-UHFFFAOYSA-L |
| XLogP | 2.02 |
| TPSA | 100.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.11 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|