C11H20NS+ — CID 87997438
3-heptyl-2-methyl-1,3-thiazol-3-ium (PubChem CID 87997438) has the molecular formula C11H20NS+ and a molecular weight of 198.35 g/mol. Its IUPAC name is 3-heptyl-2-methyl-1,3-thiazol-3-ium.
| Compound Name | 3-heptyl-2-methyl-1,3-thiazol-3-ium |
|---|---|
| PubChem CID | 87997438 |
| Molecular Formula | C11H20NS+ |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | 3-heptyl-2-methyl-1,3-thiazol-3-ium |
| SMILES | CCCCCCC[n+]1ccsc1C |
| InChI | InChI=1S/C11H20NS/c1-3-4-5-6-7-8-12-9-10-13-11(12)2/h9-10H,3-8H2,1-2H3/q+1 |
| InChIKey | FQNQIJSPPIAFBM-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|