C11H16N2S2+2 — CID 21043328
2-methyl-3-[3-(2-methyl-1,3-thiazol-3-ium-3-yl)propyl]-1,3-thiazol-3-ium (PubChem CID 21043328) has the molecular formula C11H16N2S2+2 and a molecular weight of 240.40 g/mol. Its IUPAC name is 2-methyl-3-[3-(2-methyl-1,3-thiazol-3-ium-3-yl)propyl]-1,3-thiazol-3-ium.
| Compound Name | 2-methyl-3-[3-(2-methyl-1,3-thiazol-3-ium-3-yl)propyl]-1,3-thiazol-3-ium |
|---|---|
| PubChem CID | 21043328 |
| Molecular Formula | C11H16N2S2+2 |
| Molecular Weight | 240.40 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 2-methyl-3-[3-(2-methyl-1,3-thiazol-3-ium-3-yl)propyl]-1,3-thiazol-3-ium |
| SMILES | Cc1scc[n+]1CCC[n+]1ccsc1C |
| InChI | InChI=1S/C11H16N2S2/c1-10-12(6-8-14-10)4-3-5-13-7-9-15-11(13)2/h6-9H,3-5H2,1-2H3/q+2 |
| InChIKey | JKDRIZSWVAUWRC-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.40 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|