C38H43N3O3S — CID 23080350
2-[1-(1H-benzimidazol-2-yl)but-3-enyl-[[5-[4-[(4-heptan-4-ylphenoxy)methyl]phenyl]thiophen-2-yl]methyl]amino]acetic acid (PubChem CID 23080350) has the molecular formula C38H43N3O3S and a molecular weight of 621.85 g/mol. Its IUPAC name is 2-[1-(1H-benzimidazol-2-yl)but-3-enyl-[[5-[4-[(4-heptan-4-ylphenoxy)methyl]phenyl]thiophen-2-yl]methyl]amino]acetic acid.
| Compound Name | 2-[1-(1H-benzimidazol-2-yl)but-3-enyl-[[5-[4-[(4-heptan-4-ylphenoxy)methyl]phenyl]thiophen-2-yl]methyl]amino]acetic acid |
|---|---|
| PubChem CID | 23080350 |
| Molecular Formula | C38H43N3O3S |
| Molecular Weight | 621.85 g/mol |
| Exact Mass | 621.30 |
| IUPAC Name | 2-[1-(1H-benzimidazol-2-yl)but-3-enyl-[[5-[4-[(4-heptan-4-ylphenoxy)methyl]phenyl]thiophen-2-yl]methyl]amino]acetic acid |
| SMILES | C=CCC(c1nc2ccccc2[nH]1)N(CC(=O)O)Cc1ccc(-c2ccc(COc3ccc(C(CCC)CCC)cc3)cc2)s1 |
| InChI | InChI=1S/C38H43N3O3S/c1-4-9-28(10-5-2)29-18-20-31(21-19-29)44-26-27-14-16-30(17-15-27)36-23-22-32(45-36)24-41(25-37(42)43)35(11-6-3)38-39-33-12-7-8-13-34(33)40-38/h6-8,12-23,28,35H,3-5,9-11,24-26H2,1-2H3,(H,39,40)(H,42,43) |
| InChIKey | CXWJHLFOOCNFFC-UHFFFAOYSA-N |
| XLogP | 9.76 |
| TPSA | 78.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.85 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|