C35H41N2O4S+ — CID 87924094
carboxymethyl-[[5-[4-[(4-heptan-4-ylphenoxy)methyl]phenyl]thiophen-2-yl]methyl]-methyl-(phenylcarbamoyl)azanium (PubChem CID 87924094) has the molecular formula C35H41N2O4S+ and a molecular weight of 585.79 g/mol. Its IUPAC name is carboxymethyl-[[5-[4-[(4-heptan-4-ylphenoxy)methyl]phenyl]thiophen-2-yl]methyl]-methyl-(phenylcarbamoyl)azanium.
| Compound Name | carboxymethyl-[[5-[4-[(4-heptan-4-ylphenoxy)methyl]phenyl]thiophen-2-yl]methyl]-methyl-(phenylcarbamoyl)azanium |
|---|---|
| PubChem CID | 87924094 |
| Molecular Formula | C35H41N2O4S+ |
| Molecular Weight | 585.79 g/mol |
| Exact Mass | 585.28 |
| IUPAC Name | carboxymethyl-[[5-[4-[(4-heptan-4-ylphenoxy)methyl]phenyl]thiophen-2-yl]methyl]-methyl-(phenylcarbamoyl)azanium |
| SMILES | CCCC(CCC)c1ccc(OCc2ccc(-c3ccc(C[N+](C)(CC(=O)O)C(=O)Nc4ccccc4)s3)cc2)cc1 |
| InChI | InChI=1S/C35H40N2O4S/c1-4-9-27(10-5-2)28-17-19-31(20-18-28)41-25-26-13-15-29(16-14-26)33-22-21-32(42-33)23-37(3,24-34(38)39)35(40)36-30-11-7-6-8-12-30/h6-8,11-22,27H,4-5,9-10,23-25H2,1-3H3,(H-,36,38,39,40)/p+1 |
| InChIKey | BKGDXONSDUKIJU-UHFFFAOYSA-O |
| XLogP | 8.94 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.79 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|