C20H19NO2S — CID 59152264
3-[5-(4-methoxyphenyl)thiophen-2-yl]-N-phenylpropanamide (PubChem CID 59152264) has the molecular formula C20H19NO2S and a molecular weight of 337.44 g/mol. Its IUPAC name is 3-[5-(4-methoxyphenyl)thiophen-2-yl]-N-phenylpropanamide.
| Compound Name | 3-[5-(4-methoxyphenyl)thiophen-2-yl]-N-phenylpropanamide |
|---|---|
| PubChem CID | 59152264 |
| Molecular Formula | C20H19NO2S |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | 3-[5-(4-methoxyphenyl)thiophen-2-yl]-N-phenylpropanamide |
| SMILES | COc1ccc(-c2ccc(CCC(=O)Nc3ccccc3)s2)cc1 |
| InChI | InChI=1S/C20H19NO2S/c1-23-17-9-7-15(8-10-17)19-13-11-18(24-19)12-14-20(22)21-16-5-3-2-4-6-16/h2-11,13H,12,14H2,1H3,(H,21,22) |
| InChIKey | FIKJYDHFDPCQQR-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |