C37H38N2O4S — CID 91106381
2-[2-[[4-[4-[(4-heptan-4-ylphenyl)methoxy]phenyl]-1,3-thiazol-2-yl]methyl]pyrrol-2-yl]-3-oxo-3-phenylpropanoic acid (PubChem CID 91106381) has the molecular formula C37H38N2O4S and a molecular weight of 606.79 g/mol. Its IUPAC name is 2-[2-[[4-[4-[(4-heptan-4-ylphenyl)methoxy]phenyl]-1,3-thiazol-2-yl]methyl]pyrrol-2-yl]-3-oxo-3-phenylpropanoic acid.
| Compound Name | 2-[2-[[4-[4-[(4-heptan-4-ylphenyl)methoxy]phenyl]-1,3-thiazol-2-yl]methyl]pyrrol-2-yl]-3-oxo-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 91106381 |
| Molecular Formula | C37H38N2O4S |
| Molecular Weight | 606.79 g/mol |
| Exact Mass | 606.26 |
| IUPAC Name | 2-[2-[[4-[4-[(4-heptan-4-ylphenyl)methoxy]phenyl]-1,3-thiazol-2-yl]methyl]pyrrol-2-yl]-3-oxo-3-phenylpropanoic acid |
| SMILES | CCCC(CCC)c1ccc(COc2ccc(-c3csc(CC4(C(C(=O)O)C(=O)c5ccccc5)C=CC=N4)n3)cc2)cc1 |
| InChI | InChI=1S/C37H38N2O4S/c1-3-9-27(10-4-2)28-15-13-26(14-16-28)24-43-31-19-17-29(18-20-31)32-25-44-33(39-32)23-37(21-8-22-38-37)34(36(41)42)35(40)30-11-6-5-7-12-30/h5-8,11-22,25,27,34H,3-4,9-10,23-24H2,1-2H3,(H,41,42) |
| InChIKey | KSFYMRCVRMOBMO-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.79 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|