C25H26ClN3O2S — CID 91094376
2-(6-chloro-3-pyridinyl)-1-[2-[2-[4-(2-propyl-1,3-thiazol-4-yl)phenoxy]ethyl]pyrrol-2-yl]ethanol (PubChem CID 91094376) has the molecular formula C25H26ClN3O2S and a molecular weight of 468.02 g/mol. Its IUPAC name is 2-(6-chloro-3-pyridinyl)-1-[2-[2-[4-(2-propyl-1,3-thiazol-4-yl)phenoxy]ethyl]pyrrol-2-yl]ethanol.
| Compound Name | 2-(6-chloro-3-pyridinyl)-1-[2-[2-[4-(2-propyl-1,3-thiazol-4-yl)phenoxy]ethyl]pyrrol-2-yl]ethanol |
|---|---|
| PubChem CID | 91094376 |
| Molecular Formula | C25H26ClN3O2S |
| Molecular Weight | 468.02 g/mol |
| Exact Mass | 467.14 |
| IUPAC Name | 2-(6-chloro-3-pyridinyl)-1-[2-[2-[4-(2-propyl-1,3-thiazol-4-yl)phenoxy]ethyl]pyrrol-2-yl]ethanol |
| SMILES | CCCc1nc(-c2ccc(OCCC3(C(O)Cc4ccc(Cl)nc4)C=CC=N3)cc2)cs1 |
| InChI | InChI=1S/C25H26ClN3O2S/c1-2-4-24-29-21(17-32-24)19-6-8-20(9-7-19)31-14-12-25(11-3-13-28-25)22(30)15-18-5-10-23(26)27-16-18/h3,5-11,13,16-17,22,30H,2,4,12,14-15H2,1H3 |
| InChIKey | LYACYVAODIEEAU-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.02 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|