C21H21N3O3S — CID 2308075
(E)-3-(3,4-dimethoxyphenyl)-N-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)prop-2-enamide (PubChem CID 2308075) has the molecular formula C21H21N3O3S and a molecular weight of 395.48 g/mol. Its IUPAC name is (E)-3-(3,4-dimethoxyphenyl)-N-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)prop-2-enamide.
| Compound Name | (E)-3-(3,4-dimethoxyphenyl)-N-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 2308075 |
| Molecular Formula | C21H21N3O3S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | (E)-3-(3,4-dimethoxyphenyl)-N-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)Nc2ncnc3sc4c(c23)CCCC4)cc1OC |
| InChI | InChI=1S/C21H21N3O3S/c1-26-15-9-7-13(11-16(15)27-2)8-10-18(25)24-20-19-14-5-3-4-6-17(14)28-21(19)23-12-22-20/h7-12H,3-6H2,1-2H3,(H,22,23,24,25)/b10-8+ |
| InChIKey | QYWJLGJKAIGSHM-CSKARUKUSA-N |
| XLogP | 4.24 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|