C21H23N3O4S — CID 3946042
3,4,5-trimethoxy-N-(8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-3-yl)benzamide (PubChem CID 3946042) has the molecular formula C21H23N3O4S and a molecular weight of 413.50 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-(8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-3-yl)benzamide.
| Compound Name | 3,4,5-trimethoxy-N-(8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-3-yl)benzamide |
|---|---|
| PubChem CID | 3946042 |
| Molecular Formula | C21H23N3O4S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | 3,4,5-trimethoxy-N-(8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-3-yl)benzamide |
| SMILES | COc1cc(C(=O)Nc2ncnc3sc4c(c23)CCCCC4)cc(OC)c1OC |
| InChI | InChI=1S/C21H23N3O4S/c1-26-14-9-12(10-15(27-2)18(14)28-3)20(25)24-19-17-13-7-5-4-6-8-16(13)29-21(17)23-11-22-19/h9-11H,4-8H2,1-3H3,(H,22,23,24,25) |
| InChIKey | NPEBTNPZVCZZPQ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |