C18H18N4OS2 — CID 10785411
1-(4-methoxyphenyl)-3-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)thiourea (PubChem CID 10785411) has the molecular formula C18H18N4OS2 and a molecular weight of 370.50 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-3-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)thiourea.
| Compound Name | 1-(4-methoxyphenyl)-3-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)thiourea |
|---|---|
| PubChem CID | 10785411 |
| Molecular Formula | C18H18N4OS2 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | 1-(4-methoxyphenyl)-3-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)thiourea |
| SMILES | COc1ccc(NC(=S)Nc2ncnc3sc4c(c23)CCCC4)cc1 |
| InChI | InChI=1S/C18H18N4OS2/c1-23-12-8-6-11(7-9-12)21-18(24)22-16-15-13-4-2-3-5-14(13)25-17(15)20-10-19-16/h6-10H,2-5H2,1H3,(H2,19,20,21,22,24) |
| InChIKey | VBNKHIWBAZENAD-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|