C13H17N5S2 — CID 863539
1-ethyl-3-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylamino)thiourea (PubChem CID 863539) has the molecular formula C13H17N5S2 and a molecular weight of 307.45 g/mol. Its IUPAC name is 1-ethyl-3-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylamino)thiourea.
| Compound Name | 1-ethyl-3-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylamino)thiourea |
|---|---|
| PubChem CID | 863539 |
| Molecular Formula | C13H17N5S2 |
| Molecular Weight | 307.45 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | 1-ethyl-3-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylamino)thiourea |
| SMILES | CCNC(=S)NNc1ncnc2sc3c(c12)CCCC3 |
| InChI | InChI=1S/C13H17N5S2/c1-2-14-13(19)18-17-11-10-8-5-3-4-6-9(8)20-12(10)16-7-15-11/h7H,2-6H2,1H3,(H2,14,18,19)(H,15,16,17) |
| InChIKey | FQGUQAQFDWPYPI-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 61.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.45 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|