C28H30N6O3S2 — CID 155813954
tert-butyl 3-[4-[(4-methoxyphenyl)carbamothioylamino]anilino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraene-11-carboxylate (PubChem CID 155813954) has the molecular formula C28H30N6O3S2 and a molecular weight of 562.72 g/mol. Its IUPAC name is tert-butyl 3-[4-[(4-methoxyphenyl)carbamothioylamino]anilino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraene-11-carboxylate.
| Compound Name | tert-butyl 3-[4-[(4-methoxyphenyl)carbamothioylamino]anilino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraene-11-carboxylate |
|---|---|
| PubChem CID | 155813954 |
| Molecular Formula | C28H30N6O3S2 |
| Molecular Weight | 562.72 g/mol |
| Exact Mass | 562.18 |
| IUPAC Name | tert-butyl 3-[4-[(4-methoxyphenyl)carbamothioylamino]anilino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraene-11-carboxylate |
| SMILES | COc1ccc(NC(=S)Nc2ccc(Nc3ncnc4sc5c(c34)CCN(C(=O)OC(C)(C)C)C5)cc2)cc1 |
| InChI | InChI=1S/C28H30N6O3S2/c1-28(2,3)37-27(35)34-14-13-21-22(15-34)39-25-23(21)24(29-16-30-25)31-17-5-7-18(8-6-17)32-26(38)33-19-9-11-20(36-4)12-10-19/h5-12,16H,13-15H2,1-4H3,(H,29,30,31)(H2,32,33,38) |
| InChIKey | DSFYHJCQIYOGOM-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 100.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.72 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|