C28H29ClN6O3S — CID 155813958
tert-butyl 3-[4-[(3-chloro-4-methylphenyl)carbamoylamino]anilino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraene-11-carboxylate (PubChem CID 155813958) has the molecular formula C28H29ClN6O3S and a molecular weight of 565.10 g/mol. Its IUPAC name is tert-butyl 3-[4-[(3-chloro-4-methylphenyl)carbamoylamino]anilino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraene-11-carboxylate.
| Compound Name | tert-butyl 3-[4-[(3-chloro-4-methylphenyl)carbamoylamino]anilino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraene-11-carboxylate |
|---|---|
| PubChem CID | 155813958 |
| Molecular Formula | C28H29ClN6O3S |
| Molecular Weight | 565.10 g/mol |
| Exact Mass | 564.17 |
| IUPAC Name | tert-butyl 3-[4-[(3-chloro-4-methylphenyl)carbamoylamino]anilino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraene-11-carboxylate |
| SMILES | Cc1ccc(NC(=O)Nc2ccc(Nc3ncnc4sc5c(c34)CCN(C(=O)OC(C)(C)C)C5)cc2)cc1Cl |
| InChI | InChI=1S/C28H29ClN6O3S/c1-16-5-6-19(13-21(16)29)34-26(36)33-18-9-7-17(8-10-18)32-24-23-20-11-12-35(27(37)38-28(2,3)4)14-22(20)39-25(23)31-15-30-24/h5-10,13,15H,11-12,14H2,1-4H3,(H,30,31,32)(H2,33,34,36) |
| InChIKey | KTBCVBDGWQBPJG-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 108.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.10 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |