C23H18ClN7O2S — CID 167459125
1-[3-[3-chloro-4-([1,2,4]triazolo[1,5-a]pyridin-6-yloxy)anilino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]ethanone (PubChem CID 167459125) has the molecular formula C23H18ClN7O2S and a molecular weight of 491.96 g/mol. Its IUPAC name is 1-[3-[3-chloro-4-([1,2,4]triazolo[1,5-a]pyridin-6-yloxy)anilino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]ethanone.
| Compound Name | 1-[3-[3-chloro-4-([1,2,4]triazolo[1,5-a]pyridin-6-yloxy)anilino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]ethanone |
|---|---|
| PubChem CID | 167459125 |
| Molecular Formula | C23H18ClN7O2S |
| Molecular Weight | 491.96 g/mol |
| Exact Mass | 491.09 |
| IUPAC Name | 1-[3-[3-chloro-4-([1,2,4]triazolo[1,5-a]pyridin-6-yloxy)anilino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]ethanone |
| SMILES | CC(=O)N1CCc2c(sc3ncnc(Nc4ccc(Oc5ccc6ncnn6c5)c(Cl)c4)c23)C1 |
| InChI | InChI=1S/C23H18ClN7O2S/c1-13(32)30-7-6-16-19(10-30)34-23-21(16)22(26-11-27-23)29-14-2-4-18(17(24)8-14)33-15-3-5-20-25-12-28-31(20)9-15/h2-5,8-9,11-12H,6-7,10H2,1H3,(H,26,27,29) |
| InChIKey | LDKYTWAWYNIDCZ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.96 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |